C17H18O4 — CID 11243134
9,10-dihydroxy-8-methoxy-3,6-dimethyl-3,4-dihydro-2H-anthracen-1-one (PubChem CID 11243134) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 9,10-dihydroxy-8-methoxy-3,6-dimethyl-3,4-dihydro-2H-anthracen-1-one.
| Compound Name | 9,10-dihydroxy-8-methoxy-3,6-dimethyl-3,4-dihydro-2H-anthracen-1-one |
|---|---|
| PubChem CID | 11243134 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 9,10-dihydroxy-8-methoxy-3,6-dimethyl-3,4-dihydro-2H-anthracen-1-one |
| SMILES | COc1cc(C)cc2c(O)c3c(c(O)c12)C(=O)CC(C)C3 |
| InChI | InChI=1S/C17H18O4/c1-8-4-10-14(12(18)6-8)17(20)15-11(16(10)19)5-9(2)7-13(15)21-3/h5,7-8,19-20H,4,6H2,1-3H3 |
| InChIKey | XNORBCCPBPOREQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|