C16H17NO4 — CID 11243162
(3aR,4S,7R,7aS)-2-(4-hydroxyphenyl)-3a,7a-dimethyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 11243162) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-2-(4-hydroxyphenyl)-3a,7a-dimethyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aS)-2-(4-hydroxyphenyl)-3a,7a-dimethyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 11243162 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (3aR,4S,7R,7aS)-2-(4-hydroxyphenyl)-3a,7a-dimethyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@@]12C(=O)N(c3ccc(O)cc3)C(=O)[C@]1(C)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C16H17NO4/c1-15-11-7-8-12(21-11)16(15,2)14(20)17(13(15)19)9-3-5-10(18)6-4-9/h3-6,11-12,18H,7-8H2,1-2H3/t11-,12+,15+,16- |
| InChIKey | KOLGDSSFKVFNBK-CRJCFHLZSA-N |
| XLogP | 1.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|