About 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline
1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline (PubChem CID 11243335) has the molecular formula C17H15N3S
and a molecular weight of 293.39 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline.
Molecular Properties
| Compound Name | 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline |
| PubChem CID | 11243335 |
| Molecular Formula | C17H15N3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline |
| SMILES | Cc1ccsc1-c1nc2c(C)nn(C)c2c2ccccc12 |
| InChI | InChI=1S/C17H15N3S/c1-10-8-9-21-17(10)15-12-6-4-5-7-13(12)16-14(18-15)11(2)19-20(16)3/h4-9H,1-3H3 |
| InChIKey | XRAYGKOXYAKRCD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline?
The IUPAC name of 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline (CID 11243335) is 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline.
What is the SMILES notation for 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline?
The canonical SMILES for 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline is Cc1ccsc1-c1nc2c(C)nn(C)c2c2ccccc12.
What is the InChIKey of 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline?
The InChIKey is XRAYGKOXYAKRCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3S/c1-10-8-9-21-17(10)15-12-6-4-5-7-13(12)16-14(18-15)11(2)19-20(16)3/h4-9H,1-3H3.
What are the key properties of 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline?
1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline has a molecular weight of 293.39 g/mol, XLogP of 4.47, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-(3-methylthiophen-2-yl)pyrazolo[4,5-c]isoquinoline is sourced from PubChem (CID 11243335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).