2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid

C6H4Br2O4 — CID 11243511

IUPAC2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid
SMILESO=C(O)CC1OC(=O)C(Br)=C1Br
InChIInChI=1S/C6H4Br2O4/c7-4-2(1-3(9)10)12-6(11)5(4)8/h2H,1H2,(H,9,10)
InChIKeyKKNHSJYURHHQGA-UHFFFAOYSA-N
MW299.90 g/mol
LogP1.39
Rot. Bonds2

About 2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid

2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid (PubChem CID 11243511) has the molecular formula C6H4Br2O4 and a molecular weight of 299.90 g/mol. Its IUPAC name is 2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid.

Molecular Properties

Compound Name2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid
PubChem CID11243511
Molecular FormulaC6H4Br2O4
Molecular Weight299.90 g/mol
Exact Mass297.85
IUPAC Name2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid
SMILESO=C(O)CC1OC(=O)C(Br)=C1Br
InChIInChI=1S/C6H4Br2O4/c7-4-2(1-3(9)10)12-6(11)5(4)8/h2H,1H2,(H,9,10)
InChIKeyKKNHSJYURHHQGA-UHFFFAOYSA-N
XLogP1.39
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.90
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid?
The IUPAC name of 2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid (CID 11243511) is 2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid.
What is the SMILES notation for 2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid?
The canonical SMILES for 2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid is O=C(O)CC1OC(=O)C(Br)=C1Br.
What is the InChIKey of 2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid?
The InChIKey is KKNHSJYURHHQGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Br2O4/c7-4-2(1-3(9)10)12-6(11)5(4)8/h2H,1H2,(H,9,10).
What are the key properties of 2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid?
2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid has a molecular weight of 299.90 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dibromo-5-oxo-2H-furan-2-yl)acetic acid is sourced from PubChem (CID 11243511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).