C16H19ClN2O3 — CID 11244192
6-chloro-1-(2-phenylethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione (PubChem CID 11244192) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is 6-chloro-1-(2-phenylethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 6-chloro-1-(2-phenylethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11244192 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 6-chloro-1-(2-phenylethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione |
| SMILES | CC(C)c1c(Cl)n(COCCc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H19ClN2O3/c1-11(2)13-14(17)19(16(21)18-15(13)20)10-22-9-8-12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3,(H,18,20,21) |
| InChIKey | PALBIVRDRABRDL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|