C19H33NO3 — CID 11244220
tert-butyl (2S,3R,6R)-3,6-dimethyl-2-[(E)-5-methyl-2-oxohex-3-enyl]piperidine-1-carboxylate (PubChem CID 11244220) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is tert-butyl (2S,3R,6R)-3,6-dimethyl-2-[(E)-5-methyl-2-oxohex-3-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R,6R)-3,6-dimethyl-2-[(E)-5-methyl-2-oxohex-3-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11244220 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | tert-butyl (2S,3R,6R)-3,6-dimethyl-2-[(E)-5-methyl-2-oxohex-3-enyl]piperidine-1-carboxylate |
| SMILES | CC(C)/C=C/C(=O)C[C@H]1[C@H](C)CC[C@@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33NO3/c1-13(2)8-11-16(21)12-17-14(3)9-10-15(4)20(17)18(22)23-19(5,6)7/h8,11,13-15,17H,9-10,12H2,1-7H3/b11-8+/t14-,15-,17+/m1/s1 |
| InChIKey | DRHWBYNXMBYSGG-BIALJWFKSA-N |
| XLogP | 4.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|