C23H39B — CID 11244279
prop-2-enyl-bis[(1R,3R,4R,6S)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]borane (PubChem CID 11244279) has the molecular formula C23H39B and a molecular weight of 326.38 g/mol. Its IUPAC name is prop-2-enyl-bis[(1R,3R,4R,6S)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]borane.
| Compound Name | prop-2-enyl-bis[(1R,3R,4R,6S)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]borane |
|---|---|
| PubChem CID | 11244279 |
| Molecular Formula | C23H39B |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.31 |
| IUPAC Name | prop-2-enyl-bis[(1R,3R,4R,6S)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]borane |
| SMILES | C=CCB([C@@H]1C[C@@H]2[C@H](C[C@H]1C)C2(C)C)[C@@H]1C[C@@H]2[C@H](C[C@H]1C)C2(C)C |
| InChI | InChI=1S/C23H39B/c1-8-9-24(20-12-18-16(10-14(20)2)22(18,4)5)21-13-19-17(11-15(21)3)23(19,6)7/h8,14-21H,1,9-13H2,2-7H3/t14-,15-,16+,17+,18-,19-,20-,21-/m1/s1 |
| InChIKey | DOJXPVBTKHVRTE-RLEROFIGSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|