C20H30O4 — CID 11244543
(1R,2S,9S,10E,14S,15S)-15-hydroxy-2,6,11,15-tetramethyl-8,18-dioxatricyclo[12.3.1.05,9]octadeca-5,10-dien-7-one (PubChem CID 11244543) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1R,2S,9S,10E,14S,15S)-15-hydroxy-2,6,11,15-tetramethyl-8,18-dioxatricyclo[12.3.1.05,9]octadeca-5,10-dien-7-one.
| Compound Name | (1R,2S,9S,10E,14S,15S)-15-hydroxy-2,6,11,15-tetramethyl-8,18-dioxatricyclo[12.3.1.05,9]octadeca-5,10-dien-7-one |
|---|---|
| PubChem CID | 11244543 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1R,2S,9S,10E,14S,15S)-15-hydroxy-2,6,11,15-tetramethyl-8,18-dioxatricyclo[12.3.1.05,9]octadeca-5,10-dien-7-one |
| SMILES | CC1=C2CC[C@H](C)[C@H]3CC[C@](C)(O)[C@H](CC/C(C)=C/[C@@H]2OC1=O)O3 |
| InChI | InChI=1S/C20H30O4/c1-12-5-8-18-20(4,22)10-9-16(23-18)13(2)6-7-15-14(3)19(21)24-17(15)11-12/h11,13,16-18,22H,5-10H2,1-4H3/b12-11+/t13-,16+,17-,18-,20-/m0/s1 |
| InChIKey | UIXXPUQGCNBHRT-AYZKVQOUSA-N |
| XLogP | 3.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|