C19H16N2O4 — CID 11244594
3-hydroxy-4-methoxy-N-(4-phenoxyphenyl)pyridine-2-carboxamide (PubChem CID 11244594) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-hydroxy-4-methoxy-N-(4-phenoxyphenyl)pyridine-2-carboxamide.
| Compound Name | 3-hydroxy-4-methoxy-N-(4-phenoxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11244594 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-hydroxy-4-methoxy-N-(4-phenoxyphenyl)pyridine-2-carboxamide |
| SMILES | COc1ccnc(C(=O)Nc2ccc(Oc3ccccc3)cc2)c1O |
| InChI | InChI=1S/C19H16N2O4/c1-24-16-11-12-20-17(18(16)22)19(23)21-13-7-9-15(10-8-13)25-14-5-3-2-4-6-14/h2-12,22H,1H3,(H,21,23) |
| InChIKey | GWDLWYZCTCTWKV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |