C20H22N2O3 — CID 11244651
N-hydroxy-3-[1-(3-naphthalen-2-ylpropyl)-5-oxo-2H-pyrrol-4-yl]propanamide (PubChem CID 11244651) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-hydroxy-3-[1-(3-naphthalen-2-ylpropyl)-5-oxo-2H-pyrrol-4-yl]propanamide.
| Compound Name | N-hydroxy-3-[1-(3-naphthalen-2-ylpropyl)-5-oxo-2H-pyrrol-4-yl]propanamide |
|---|---|
| PubChem CID | 11244651 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-hydroxy-3-[1-(3-naphthalen-2-ylpropyl)-5-oxo-2H-pyrrol-4-yl]propanamide |
| SMILES | O=C(CCC1=CCN(CCCc2ccc3ccccc3c2)C1=O)NO |
| InChI | InChI=1S/C20H22N2O3/c23-19(21-25)10-9-17-11-13-22(20(17)24)12-3-4-15-7-8-16-5-1-2-6-18(16)14-15/h1-2,5-8,11,14,25H,3-4,9-10,12-13H2,(H,21,23) |
| InChIKey | ZIQAJFVTKUTVEP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|