C16H15F3O3S — CID 11244842
1-[(1R,2S,3R,4S)-3-(benzenesulfonyl)-2-bicyclo[2.2.2]oct-5-enyl]-2,2,2-trifluoroethanone (PubChem CID 11244842) has the molecular formula C16H15F3O3S and a molecular weight of 344.35 g/mol. Its IUPAC name is 1-[(1R,2S,3R,4S)-3-(benzenesulfonyl)-2-bicyclo[2.2.2]oct-5-enyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(1R,2S,3R,4S)-3-(benzenesulfonyl)-2-bicyclo[2.2.2]oct-5-enyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 11244842 |
| Molecular Formula | C16H15F3O3S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-[(1R,2S,3R,4S)-3-(benzenesulfonyl)-2-bicyclo[2.2.2]oct-5-enyl]-2,2,2-trifluoroethanone |
| SMILES | O=C([C@H]1[C@H](S(=O)(=O)c2ccccc2)[C@@H]2C=C[C@H]1CC2)C(F)(F)F |
| InChI | InChI=1S/C16H15F3O3S/c17-16(18,19)15(20)13-10-6-8-11(9-7-10)14(13)23(21,22)12-4-2-1-3-5-12/h1-6,8,10-11,13-14H,7,9H2/t10-,11+,13+,14+/m0/s1 |
| InChIKey | XBLNUWSOSGOKQZ-OIMNJJJWSA-N |
| XLogP | 3.17 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|