C22H21NO3 — CID 11244952
(4-methylphenyl) 4-methyl-3-oxo-1,2,5,6-tetrahydrobenzo[c]quinolizine-8-carboxylate (PubChem CID 11244952) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is (4-methylphenyl) 4-methyl-3-oxo-1,2,5,6-tetrahydrobenzo[c]quinolizine-8-carboxylate.
| Compound Name | (4-methylphenyl) 4-methyl-3-oxo-1,2,5,6-tetrahydrobenzo[c]quinolizine-8-carboxylate |
|---|---|
| PubChem CID | 11244952 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (4-methylphenyl) 4-methyl-3-oxo-1,2,5,6-tetrahydrobenzo[c]quinolizine-8-carboxylate |
| SMILES | CC1=C2CCc3cc(C(=O)Oc4ccc(C)cc4)ccc3N2CCC1=O |
| InChI | InChI=1S/C22H21NO3/c1-14-3-7-18(8-4-14)26-22(25)17-6-10-20-16(13-17)5-9-19-15(2)21(24)11-12-23(19)20/h3-4,6-8,10,13H,5,9,11-12H2,1-2H3 |
| InChIKey | GVRAYSMKJYQJNC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|