About 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene
2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene (PubChem CID 11245030) has the molecular formula C19H14N2O5
and a molecular weight of 350.33 g/mol. Its IUPAC name is 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene.
Molecular Properties
| Compound Name | 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene |
| PubChem CID | 11245030 |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene |
| SMILES | COc1c([N+](=O)[O-])cc(/C=C/c2ccc3ccccc3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14N2O5/c1-26-19-17(20(22)23)11-14(12-18(19)21(24)25)7-6-13-8-9-15-4-2-3-5-16(15)10-13/h2-12H,1H3/b7-6+ |
| InChIKey | BLHQCCBDGWGFJW-VOTSOKGWSA-N |
| XLogP | 4.84 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene?
The IUPAC name of 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene (CID 11245030) is 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene.
What is the SMILES notation for 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene?
The canonical SMILES for 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene is COc1c([N+](=O)[O-])cc(/C=C/c2ccc3ccccc3c2)cc1[N+](=O)[O-].
What is the InChIKey of 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene?
The InChIKey is BLHQCCBDGWGFJW-VOTSOKGWSA-N. The full InChI is InChI=1S/C19H14N2O5/c1-26-19-17(20(22)23)11-14(12-18(19)21(24)25)7-6-13-8-9-15-4-2-3-5-16(15)10-13/h2-12H,1H3/b7-6+.
What are the key properties of 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene?
2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene has a molecular weight of 350.33 g/mol, XLogP of 4.84, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene is sourced from PubChem (CID 11245030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).