C24H23NO2 — CID 11245263
(4aR,5S,10bR)-5-(3-phenoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 11245263) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is (4aR,5S,10bR)-5-(3-phenoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aR,5S,10bR)-5-(3-phenoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 11245263 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (4aR,5S,10bR)-5-(3-phenoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | c1ccc(Oc2cccc([C@H]3Nc4ccccc4[C@@H]4OCCC[C@H]34)c2)cc1 |
| InChI | InChI=1S/C24H23NO2/c1-2-9-18(10-3-1)27-19-11-6-8-17(16-19)23-21-13-7-15-26-24(21)20-12-4-5-14-22(20)25-23/h1-6,8-12,14,16,21,23-25H,7,13,15H2/t21-,23-,24+/m1/s1 |
| InChIKey | DBLRCEIXKPSEGY-JRFVFWCSSA-N |
| XLogP | 6.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |