C20H20F3NO2 — CID 11245421
[(E)-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidate (PubChem CID 11245421) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is [(E)-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidate.
| Compound Name | [(E)-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidate |
|---|---|
| PubChem CID | 11245421 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | [(E)-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidate |
| SMILES | COc1ccc(/N=C(\OC/C=C/CCc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3NO2/c1-25-18-13-11-17(12-14-18)24-19(20(21,22)23)26-15-7-3-6-10-16-8-4-2-5-9-16/h2-5,7-9,11-14H,6,10,15H2,1H3/b7-3+,24-19- |
| InChIKey | VVHKDUVEOIIHML-KGMCZFSASA-N |
| XLogP | 5.49 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|