C19H24O7 — CID 11245453
ethyl (3aR,6aS,7R,10aS)-7-(2-ethoxy-2-oxoethyl)-1-hydroxy-10-oxo-3,3a,6,6a-tetrahydro-1H-benzo[d][2]benzofuran-7-carboxylate (PubChem CID 11245453) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is ethyl (3aR,6aS,7R,10aS)-7-(2-ethoxy-2-oxoethyl)-1-hydroxy-10-oxo-3,3a,6,6a-tetrahydro-1H-benzo[d][2]benzofuran-7-carboxylate.
| Compound Name | ethyl (3aR,6aS,7R,10aS)-7-(2-ethoxy-2-oxoethyl)-1-hydroxy-10-oxo-3,3a,6,6a-tetrahydro-1H-benzo[d][2]benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 11245453 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | ethyl (3aR,6aS,7R,10aS)-7-(2-ethoxy-2-oxoethyl)-1-hydroxy-10-oxo-3,3a,6,6a-tetrahydro-1H-benzo[d][2]benzofuran-7-carboxylate |
| SMILES | CCOC(=O)C[C@@]1(C(=O)OCC)C=CC(=O)[C@]23C(O)OC[C@@H]2C=CC[C@@H]31 |
| InChI | InChI=1S/C19H24O7/c1-3-24-15(21)10-18(16(22)25-4-2)9-8-14(20)19-12(11-26-17(19)23)6-5-7-13(18)19/h5-6,8-9,12-13,17,23H,3-4,7,10-11H2,1-2H3/t12-,13+,17?,18-,19-/m0/s1 |
| InChIKey | DQMHLTQBACGPIW-CNNKAVGXSA-N |
| XLogP | 1.16 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|