C20H21N3O2S — CID 11245566
ethyl (E)-3-[4-[4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]sulfanylphenyl]prop-2-enoate (PubChem CID 11245566) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is ethyl (E)-3-[4-[4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]sulfanylphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]sulfanylphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11245566 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | ethyl (E)-3-[4-[4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]sulfanylphenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(Sc2ccc(NC3=NCCN3)cc2)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-2-25-19(24)12-5-15-3-8-17(9-4-15)26-18-10-6-16(7-11-18)23-20-21-13-14-22-20/h3-12H,2,13-14H2,1H3,(H2,21,22,23)/b12-5+ |
| InChIKey | UMHOWCYSLVNWRE-LFYBBSHMSA-N |
| XLogP | 3.79 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|