C21H28N4O2 — CID 11245600
(E)-3-[3-[1-(1-ethylpiperidin-3-yl)-4,5-dimethylimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 11245600) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is (E)-3-[3-[1-(1-ethylpiperidin-3-yl)-4,5-dimethylimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[3-[1-(1-ethylpiperidin-3-yl)-4,5-dimethylimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 11245600 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (E)-3-[3-[1-(1-ethylpiperidin-3-yl)-4,5-dimethylimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CCN1CCCC(n2c(-c3cccc(/C=C/C(=O)NO)c3)nc(C)c2C)C1 |
| InChI | InChI=1S/C21H28N4O2/c1-4-24-12-6-9-19(14-24)25-16(3)15(2)22-21(25)18-8-5-7-17(13-18)10-11-20(26)23-27/h5,7-8,10-11,13,19,27H,4,6,9,12,14H2,1-3H3,(H,23,26)/b11-10+ |
| InChIKey | BMVUXKYOODZALF-ZHACJKMWSA-N |
| XLogP | 3.34 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|