C18H14N2O5S — CID 11245663
2-[[1-(benzenesulfinyl)-4-hydroxyisoquinoline-3-carbonyl]amino]acetic acid (PubChem CID 11245663) has the molecular formula C18H14N2O5S and a molecular weight of 370.39 g/mol. Its IUPAC name is 2-[[1-(benzenesulfinyl)-4-hydroxyisoquinoline-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-(benzenesulfinyl)-4-hydroxyisoquinoline-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 11245663 |
| Molecular Formula | C18H14N2O5S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-[[1-(benzenesulfinyl)-4-hydroxyisoquinoline-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1nc(S(=O)c2ccccc2)c2ccccc2c1O |
| InChI | InChI=1S/C18H14N2O5S/c21-14(22)10-19-17(24)15-16(23)12-8-4-5-9-13(12)18(20-15)26(25)11-6-2-1-3-7-11/h1-9,23H,10H2,(H,19,24)(H,21,22) |
| InChIKey | UIUUKHDOXNLGIY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |