C13H8F5N3O3S — CID 11245996
1-(2,3,4,5,6-pentafluorophenyl)-3-(4-sulfamoylphenyl)urea (PubChem CID 11245996) has the molecular formula C13H8F5N3O3S and a molecular weight of 381.28 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 11245996 |
| Molecular Formula | C13H8F5N3O3S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)-3-(4-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Nc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H8F5N3O3S/c14-7-8(15)10(17)12(11(18)9(7)16)21-13(22)20-5-1-3-6(4-2-5)25(19,23)24/h1-4H,(H2,19,23,24)(H2,20,21,22) |
| InChIKey | IOSBUNBTXXXMFG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|