C14H26O6P2S — CID 11246081
2,5-bis(diethoxyphosphorylmethyl)thiophene (PubChem CID 11246081) has the molecular formula C14H26O6P2S and a molecular weight of 384.37 g/mol. Its IUPAC name is 2,5-bis(diethoxyphosphorylmethyl)thiophene.
| Compound Name | 2,5-bis(diethoxyphosphorylmethyl)thiophene |
|---|---|
| PubChem CID | 11246081 |
| Molecular Formula | C14H26O6P2S |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2,5-bis(diethoxyphosphorylmethyl)thiophene |
| SMILES | CCOP(=O)(Cc1ccc(CP(=O)(OCC)OCC)s1)OCC |
| InChI | InChI=1S/C14H26O6P2S/c1-5-17-21(15,18-6-2)11-13-9-10-14(23-13)12-22(16,19-7-3)20-8-4/h9-10H,5-8,11-12H2,1-4H3 |
| InChIKey | ASHZCIUABYZDOJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|