C20H38O5Si — CID 11246165
(1S)-1-[(2R,3aS,5R,6R,8Z,10aS)-5-ethyl-6-triethylsilyloxy-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonin-2-yl]ethane-1,2-diol (PubChem CID 11246165) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is (1S)-1-[(2R,3aS,5R,6R,8Z,10aS)-5-ethyl-6-triethylsilyloxy-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonin-2-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(2R,3aS,5R,6R,8Z,10aS)-5-ethyl-6-triethylsilyloxy-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonin-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 11246165 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (1S)-1-[(2R,3aS,5R,6R,8Z,10aS)-5-ethyl-6-triethylsilyloxy-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonin-2-yl]ethane-1,2-diol |
| SMILES | CC[C@H]1O[C@H]2C[C@H]([C@@H](O)CO)O[C@H]2C/C=C\C[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H38O5Si/c1-5-16-18(25-26(6-2,7-3)8-4)12-10-9-11-17-20(23-16)13-19(24-17)15(22)14-21/h9-10,15-22H,5-8,11-14H2,1-4H3/b10-9-/t15-,16+,17-,18+,19+,20-/m0/s1 |
| InChIKey | RVTHIJCMIOCXOB-OUJBKKIGSA-N |
| XLogP | 3.40 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|