C23H32O5 — CID 11246229
methyl (3R,4aR,6aR,12aR,12bS)-3,11-dihydroxy-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-9-carboxylate (PubChem CID 11246229) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is methyl (3R,4aR,6aR,12aR,12bS)-3,11-dihydroxy-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-9-carboxylate.
| Compound Name | methyl (3R,4aR,6aR,12aR,12bS)-3,11-dihydroxy-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-9-carboxylate |
|---|---|
| PubChem CID | 11246229 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | methyl (3R,4aR,6aR,12aR,12bS)-3,11-dihydroxy-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-9-carboxylate |
| SMILES | COC(=O)c1cc(O)c2c(c1)O[C@]1(C)CC[C@H]3C(C)(C)[C@H](O)CC[C@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C23H32O5/c1-21(2)17-6-9-23(4)18(22(17,3)8-7-19(21)25)12-14-15(24)10-13(20(26)27-5)11-16(14)28-23/h10-11,17-19,24-25H,6-9,12H2,1-5H3/t17-,18+,19+,22-,23+/m0/s1 |
| InChIKey | HHILEXGUMFEBEW-ASXKRPDZSA-N |
| XLogP | 4.09 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |