C22H34O6 — CID 11246410
(1R,3S,8R,10S,13S)-13-[(2S,3R)-2-[(2S)-but-3-en-2-yl]oxan-3-yl]oxy-10-methyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-one (PubChem CID 11246410) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is (1R,3S,8R,10S,13S)-13-[(2S,3R)-2-[(2S)-but-3-en-2-yl]oxan-3-yl]oxy-10-methyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-one.
| Compound Name | (1R,3S,8R,10S,13S)-13-[(2S,3R)-2-[(2S)-but-3-en-2-yl]oxan-3-yl]oxy-10-methyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-one |
|---|---|
| PubChem CID | 11246410 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (1R,3S,8R,10S,13S)-13-[(2S,3R)-2-[(2S)-but-3-en-2-yl]oxan-3-yl]oxy-10-methyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-one |
| SMILES | C=C[C@H](C)[C@@H]1OCCC[C@H]1O[C@H]1CC[C@H]2O[C@H]3CCCO[C@@H]3C[C@]2(C)OC1=O |
| InChI | InChI=1S/C22H34O6/c1-4-14(2)20-16(8-6-12-25-20)26-17-9-10-19-22(3,28-21(17)23)13-18-15(27-19)7-5-11-24-18/h4,14-20H,1,5-13H2,2-3H3/t14-,15-,16+,17-,18+,19+,20-,22-/m0/s1 |
| InChIKey | ATJFMECCWNNOLK-IMUPUBGJSA-N |
| XLogP | 3.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|