C27H30BNO — CID 11246432
(3aS)-1-(4-tert-butylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole (PubChem CID 11246432) has the molecular formula C27H30BNO and a molecular weight of 395.36 g/mol. Its IUPAC name is (3aS)-1-(4-tert-butylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole.
| Compound Name | (3aS)-1-(4-tert-butylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 11246432 |
| Molecular Formula | C27H30BNO |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | (3aS)-1-(4-tert-butylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
| SMILES | CC(C)(C)c1ccc(B2OC(c3ccccc3)(c3ccccc3)[C@@H]3CCCN23)cc1 |
| InChI | InChI=1S/C27H30BNO/c1-26(2,3)21-16-18-24(19-17-21)28-29-20-10-15-25(29)27(30-28,22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-9,11-14,16-19,25H,10,15,20H2,1-3H3/t25-/m0/s1 |
| InChIKey | CQPNTKIDUAWHNR-VWLOTQADSA-N |
| XLogP | 5.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|