C20H27N7O2 — CID 11246507
2-[(2R)-1-[8-ethyl-4-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]piperidin-2-yl]ethanol (PubChem CID 11246507) has the molecular formula C20H27N7O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-[(2R)-1-[8-ethyl-4-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]piperidin-2-yl]ethanol.
| Compound Name | 2-[(2R)-1-[8-ethyl-4-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 11246507 |
| Molecular Formula | C20H27N7O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-[(2R)-1-[8-ethyl-4-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]piperidin-2-yl]ethanol |
| SMILES | CCc1cnn2c(NCc3ccc[n+]([O-])c3)nc(N3CCCC[C@@H]3CCO)nc12 |
| InChI | InChI=1S/C20H27N7O2/c1-2-16-13-22-27-18(16)23-20(26-10-4-3-7-17(26)8-11-28)24-19(27)21-12-15-6-5-9-25(29)14-15/h5-6,9,13-14,17,28H,2-4,7-8,10-12H2,1H3,(H,21,23,24)/t17-/m1/s1 |
| InChIKey | SQEYWRAZCRSDTE-QGZVFWFLSA-N |
| XLogP | 1.67 |
| TPSA | 105.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|