C21H26ClN5O — CID 11246568
3-(5-chloro-2-pyridinyl)-9-heptan-4-yl-6-methyl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one (PubChem CID 11246568) has the molecular formula C21H26ClN5O and a molecular weight of 399.93 g/mol. Its IUPAC name is 3-(5-chloro-2-pyridinyl)-9-heptan-4-yl-6-methyl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one.
| Compound Name | 3-(5-chloro-2-pyridinyl)-9-heptan-4-yl-6-methyl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
|---|---|
| PubChem CID | 11246568 |
| Molecular Formula | C21H26ClN5O |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 3-(5-chloro-2-pyridinyl)-9-heptan-4-yl-6-methyl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
| SMILES | CCCC(CCC)N1CCn2c(=O)n(-c3ccc(Cl)cn3)c3nc(C)cc1c32 |
| InChI | InChI=1S/C21H26ClN5O/c1-4-6-16(7-5-2)25-10-11-26-19-17(25)12-14(3)24-20(19)27(21(26)28)18-9-8-15(22)13-23-18/h8-9,12-13,16H,4-7,10-11H2,1-3H3 |
| InChIKey | UBFNQLMFHYDCIG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |