C23H37NO3Si — CID 11246675
benzyl (2R,3R)-2-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate (PubChem CID 11246675) has the molecular formula C23H37NO3Si and a molecular weight of 403.64 g/mol. Its IUPAC name is benzyl (2R,3R)-2-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate.
| Compound Name | benzyl (2R,3R)-2-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11246675 |
| Molecular Formula | C23H37NO3Si |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | benzyl (2R,3R)-2-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate |
| SMILES | C=CCC[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H37NO3Si/c1-7-8-15-20-21(27-28(5,6)23(2,3)4)16-12-17-24(20)22(25)26-18-19-13-10-9-11-14-19/h7,9-11,13-14,20-21H,1,8,12,15-18H2,2-6H3/t20-,21-/m1/s1 |
| InChIKey | ZMAWWKDNBLCLIA-NHCUHLMSSA-N |
| XLogP | 6.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|