C26H32O2Si — CID 11246709
3-methoxyprop-1-ynyl-diphenyl-[[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]oxy]silane (PubChem CID 11246709) has the molecular formula C26H32O2Si and a molecular weight of 404.63 g/mol. Its IUPAC name is 3-methoxyprop-1-ynyl-diphenyl-[[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]oxy]silane.
| Compound Name | 3-methoxyprop-1-ynyl-diphenyl-[[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]oxy]silane |
|---|---|
| PubChem CID | 11246709 |
| Molecular Formula | C26H32O2Si |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 3-methoxyprop-1-ynyl-diphenyl-[[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]oxy]silane |
| SMILES | COCC#C[Si](O[C@H]1C[C@H]2C[C@@H]([C@@H]1C)C2(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32O2Si/c1-20-24-18-21(26(24,2)3)19-25(20)28-29(17-11-16-27-4,22-12-7-5-8-13-22)23-14-9-6-10-15-23/h5-10,12-15,20-21,24-25H,16,18-19H2,1-4H3/t20-,21+,24-,25-/m0/s1 |
| InChIKey | XMNHNFMNGSJJNC-JQOLTRQRSA-N |
| XLogP | 4.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|