C24H20ClNO3 — CID 11246752
6-[2-[3-[(2-chlorophenyl)methoxy]phenyl]cyclopenten-1-yl]pyridine-2-carboxylic acid (PubChem CID 11246752) has the molecular formula C24H20ClNO3 and a molecular weight of 405.88 g/mol. Its IUPAC name is 6-[2-[3-[(2-chlorophenyl)methoxy]phenyl]cyclopenten-1-yl]pyridine-2-carboxylic acid.
| Compound Name | 6-[2-[3-[(2-chlorophenyl)methoxy]phenyl]cyclopenten-1-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 11246752 |
| Molecular Formula | C24H20ClNO3 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 6-[2-[3-[(2-chlorophenyl)methoxy]phenyl]cyclopenten-1-yl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(C2=C(c3cccc(OCc4ccccc4Cl)c3)CCC2)n1 |
| InChI | InChI=1S/C24H20ClNO3/c25-21-11-2-1-6-17(21)15-29-18-8-3-7-16(14-18)19-9-4-10-20(19)22-12-5-13-23(26-22)24(27)28/h1-3,5-8,11-14H,4,9-10,15H2,(H,27,28) |
| InChIKey | CWQRSRQPBPOENP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |