C27H38O3 — CID 11246875
1,13-dihydroxy-2,12-dimethyl-2,12-diphenyltridecan-7-one (PubChem CID 11246875) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is 1,13-dihydroxy-2,12-dimethyl-2,12-diphenyltridecan-7-one.
| Compound Name | 1,13-dihydroxy-2,12-dimethyl-2,12-diphenyltridecan-7-one |
|---|---|
| PubChem CID | 11246875 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 1,13-dihydroxy-2,12-dimethyl-2,12-diphenyltridecan-7-one |
| SMILES | CC(CO)(CCCCC(=O)CCCCC(C)(CO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H38O3/c1-26(21-28,23-13-5-3-6-14-23)19-11-9-17-25(30)18-10-12-20-27(2,22-29)24-15-7-4-8-16-24/h3-8,13-16,28-29H,9-12,17-22H2,1-2H3 |
| InChIKey | OCDKZSIVJWVBQD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|