C26H28N2O3 — CID 11247050
1-(2,2-diphenylethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 11247050) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | 1-(2,2-diphenylethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 11247050 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1-(2,2-diphenylethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | COc1cc2c(cc1OC)C(CC(c1ccccc1)c1ccccc1)N(C(N)=O)CC2 |
| InChI | InChI=1S/C26H28N2O3/c1-30-24-15-20-13-14-28(26(27)29)23(22(20)17-25(24)31-2)16-21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,15,17,21,23H,13-14,16H2,1-2H3,(H2,27,29) |
| InChIKey | GZZRSHXGXPXWFV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |