C26H42O3Si — CID 11247441
methyl (3R,3aR)-3a-methyl-3-propan-2-yl-5a-triethylsilyloxy-2,3,4,5,6,7-hexahydrobenzo[f]azulene-9-carboxylate (PubChem CID 11247441) has the molecular formula C26H42O3Si and a molecular weight of 430.71 g/mol. Its IUPAC name is methyl (3R,3aR)-3a-methyl-3-propan-2-yl-5a-triethylsilyloxy-2,3,4,5,6,7-hexahydrobenzo[f]azulene-9-carboxylate.
| Compound Name | methyl (3R,3aR)-3a-methyl-3-propan-2-yl-5a-triethylsilyloxy-2,3,4,5,6,7-hexahydrobenzo[f]azulene-9-carboxylate |
|---|---|
| PubChem CID | 11247441 |
| Molecular Formula | C26H42O3Si |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | methyl (3R,3aR)-3a-methyl-3-propan-2-yl-5a-triethylsilyloxy-2,3,4,5,6,7-hexahydrobenzo[f]azulene-9-carboxylate |
| SMILES | CC[Si](CC)(CC)OC12CCC=C(C(=O)OC)C1=CC1=CC[C@H](C(C)C)[C@@]1(C)CC2 |
| InChI | InChI=1S/C26H42O3Si/c1-8-30(9-2,10-3)29-26-15-11-12-21(24(27)28-7)23(26)18-20-13-14-22(19(4)5)25(20,6)16-17-26/h12-13,18-19,22H,8-11,14-17H2,1-7H3/t22-,25+,26?/m1/s1 |
| InChIKey | RNFHLVDBDDYCJU-ZQLHYOEWSA-N |
| XLogP | 6.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|