C23H24N2O3 — CID 1124745
3-(3,4-dimethoxyphenyl)-N-(2-ethyl-3-methylquinolin-4-yl)prop-2-enamide (PubChem CID 1124745) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-(2-ethyl-3-methylquinolin-4-yl)prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-(2-ethyl-3-methylquinolin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1124745 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-(2-ethyl-3-methylquinolin-4-yl)prop-2-enamide |
| SMILES | CCc1nc2ccccc2c(NC(=O)C=Cc2ccc(OC)c(OC)c2)c1C |
| InChI | InChI=1S/C23H24N2O3/c1-5-18-15(2)23(17-8-6-7-9-19(17)24-18)25-22(26)13-11-16-10-12-20(27-3)21(14-16)28-4/h6-14H,5H2,1-4H3,(H,24,25,26) |
| InChIKey | DQNHVMILWWKIQZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|