C21H24N6O3S — CID 11247672
2-[1-[1-(4-methoxy-2-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]-1,2,5-thiadiazolidine 1,1-dioxide (PubChem CID 11247672) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is 2-[1-[1-(4-methoxy-2-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]-1,2,5-thiadiazolidine 1,1-dioxide.
| Compound Name | 2-[1-[1-(4-methoxy-2-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]-1,2,5-thiadiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 11247672 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[1-[1-(4-methoxy-2-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]-1,2,5-thiadiazolidine 1,1-dioxide |
| SMILES | COc1ccc(N2CCc3c(-n4ccc(N5CCNS5(=O)=O)n4)cc(C)nc32)c(C)c1 |
| InChI | InChI=1S/C21H24N6O3S/c1-14-12-16(30-3)4-5-18(14)25-9-6-17-19(13-15(2)23-21(17)25)26-10-7-20(24-26)27-11-8-22-31(27,28)29/h4-5,7,10,12-13,22H,6,8-9,11H2,1-3H3 |
| InChIKey | JTUKIQHISYGDML-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |