C18F12 — CID 11247765
1,2,3,4,5,6,7,8,9,10,11,12-dodecafluorotetracene (PubChem CID 11247765) has the molecular formula C18F12 and a molecular weight of 444.17 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,10,11,12-dodecafluorotetracene.
| Compound Name | 1,2,3,4,5,6,7,8,9,10,11,12-dodecafluorotetracene |
|---|---|
| PubChem CID | 11247765 |
| Molecular Formula | C18F12 |
| Molecular Weight | 444.17 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,10,11,12-dodecafluorotetracene |
| SMILES | Fc1c(F)c(F)c2c(F)c3c(F)c4c(F)c(F)c(F)c(F)c4c(F)c3c(F)c2c1F |
| InChI | InChI=1S/C18F12/c19-7-1-2(9(21)5-3(7)11(23)15(27)17(29)13(5)25)10(22)6-4(8(1)20)12(24)16(28)18(30)14(6)26 |
| InChIKey | HWJZHIKCLNIPQV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.17 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|