About 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea
1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea (PubChem CID 11248021) has the molecular formula C26H26N6O2
and a molecular weight of 454.53 g/mol. Its IUPAC name is 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea.
Molecular Properties
| Compound Name | 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea |
| PubChem CID | 11248021 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea |
| SMILES | Nc1nc(N)c(-c2ccc(NC(=O)NCc3ccccc3)cc2)c(COCc2ccccc2)n1 |
| InChI | InChI=1S/C26H26N6O2/c27-24-23(22(31-25(28)32-24)17-34-16-19-9-5-2-6-10-19)20-11-13-21(14-12-20)30-26(33)29-15-18-7-3-1-4-8-18/h1-14H,15-17H2,(H2,29,30,33)(H4,27,28,31,32) |
| InChIKey | CRWVLECQBDATTM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea?
The IUPAC name of 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea (CID 11248021) is 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea.
What is the SMILES notation for 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea?
The canonical SMILES for 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea is Nc1nc(N)c(-c2ccc(NC(=O)NCc3ccccc3)cc2)c(COCc2ccccc2)n1.
What is the InChIKey of 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea?
The InChIKey is CRWVLECQBDATTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N6O2/c27-24-23(22(31-25(28)32-24)17-34-16-19-9-5-2-6-10-19)20-11-13-21(14-12-20)30-26(33)29-15-18-7-3-1-4-8-18/h1-14H,15-17H2,(H2,29,30,33)(H4,27,28,31,32).
What are the key properties of 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea?
1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea has a molecular weight of 454.53 g/mol, XLogP of 4.35, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]urea is sourced from PubChem (CID 11248021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).