C26H40O7 — CID 11248280
[(2S,3S,4E,6R)-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]-6-prop-2-enyloxan-3-yl] octanoate (PubChem CID 11248280) has the molecular formula C26H40O7 and a molecular weight of 464.60 g/mol. Its IUPAC name is [(2S,3S,4E,6R)-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]-6-prop-2-enyloxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4E,6R)-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]-6-prop-2-enyloxan-3-yl] octanoate |
|---|---|
| PubChem CID | 11248280 |
| Molecular Formula | C26H40O7 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | [(2S,3S,4E,6R)-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]-6-prop-2-enyloxan-3-yl] octanoate |
| SMILES | C=CC[C@@H]1C/C(=C\C(=O)OC)[C@H](OC(=O)CCCCCCC)[C@](OC)(C(C)(C)/C=C/C=O)O1 |
| InChI | InChI=1S/C26H40O7/c1-7-9-10-11-12-15-22(28)32-24-20(19-23(29)30-5)18-21(14-8-2)33-26(24,31-6)25(3,4)16-13-17-27/h8,13,16-17,19,21,24H,2,7,9-12,14-15,18H2,1,3-6H3/b16-13+,20-19+/t21-,24+,26-/m1/s1 |
| InChIKey | ZGEADKNYGXXSRP-CBJVGMTGSA-N |
| XLogP | 4.85 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|