About 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide
2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide (PubChem CID 11248801) has the molecular formula C27H35Cl2N3O
and a molecular weight of 488.50 g/mol. Its IUPAC name is 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide.
Molecular Properties
| Compound Name | 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide |
| PubChem CID | 11248801 |
| Molecular Formula | C27H35Cl2N3O |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)Cc1c(-c2ccc(Cl)cc2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C27H35Cl2N3O/c1-3-5-7-9-17-31(18-10-8-6-4-2)26(33)19-24-27(21-11-13-22(28)14-12-21)30-25-16-15-23(29)20-32(24)25/h11-16,20H,3-10,17-19H2,1-2H3 |
| InChIKey | GQCXMBKAWBPHMG-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide?
The IUPAC name of 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide (CID 11248801) is 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide.
What is the SMILES notation for 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide?
The canonical SMILES for 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide is CCCCCCN(CCCCCC)C(=O)Cc1c(-c2ccc(Cl)cc2)nc2ccc(Cl)cn12.
What is the InChIKey of 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide?
The InChIKey is GQCXMBKAWBPHMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35Cl2N3O/c1-3-5-7-9-17-31(18-10-8-6-4-2)26(33)19-24-27(21-11-13-22(28)14-12-21)30-25-16-15-23(29)20-32(24)25/h11-16,20H,3-10,17-19H2,1-2H3.
What are the key properties of 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide?
2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide has a molecular weight of 488.50 g/mol, XLogP of 7.84, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dihexylacetamide is sourced from PubChem (CID 11248801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).