C25H42N2O4Si2 — CID 11248869
(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carbonitrile (PubChem CID 11248869) has the molecular formula C25H42N2O4Si2 and a molecular weight of 490.79 g/mol. Its IUPAC name is (2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carbonitrile.
| Compound Name | (2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 11248869 |
| Molecular Formula | C25H42N2O4Si2 |
| Molecular Weight | 490.79 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | (2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carbonitrile |
| SMILES | COc1ccc(CN2C(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2C#N)cc1 |
| InChI | InChI=1S/C25H42N2O4Si2/c1-24(2,3)32(8,9)30-21-20(16-26)27(17-18-12-14-19(29-7)15-13-18)23(28)22(21)31-33(10,11)25(4,5)6/h12-15,20-22H,17H2,1-11H3/t20-,21+,22-/m1/s1 |
| InChIKey | CYOFOBCXHYNSBJ-BHIFYINESA-N |
| XLogP | 5.71 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.79 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|