About 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile
3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile (PubChem CID 11249411) has the molecular formula C24H26N4O2
and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
| PubChem CID | 11249411 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc5c(c4)OCO5)CC3)c2c1 |
| InChI | InChI=1S/C24H26N4O2/c25-15-18-4-6-22-21(13-18)19(16-26-22)3-1-2-8-27-9-11-28(12-10-27)20-5-7-23-24(14-20)30-17-29-23/h4-7,13-14,16,26H,1-3,8-12,17H2 |
| InChIKey | XBNXSLUDGIRCOM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile?
The IUPAC name of 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile (CID 11249411) is 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
What is the SMILES notation for 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile?
The canonical SMILES for 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile is N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc5c(c4)OCO5)CC3)c2c1.
What is the InChIKey of 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile?
The InChIKey is XBNXSLUDGIRCOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N4O2/c25-15-18-4-6-22-21(13-18)19(16-26-22)3-1-2-8-27-9-11-28(12-10-27)20-5-7-23-24(14-20)30-17-29-23/h4-7,13-14,16,26H,1-3,8-12,17H2.
What are the key properties of 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile?
3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile has a molecular weight of 402.50 g/mol, XLogP of 3.91, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile is sourced from PubChem (CID 11249411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).