C28H48N4O5 — CID 11249418
ethyl (E,4S)-6-methyl-4-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-(1,2,3,6-tetrahydropyridine-5-carbonylamino)pentanoyl]amino]pentanoyl]amino]hept-2-enoate (PubChem CID 11249418) has the molecular formula C28H48N4O5 and a molecular weight of 520.72 g/mol. Its IUPAC name is ethyl (E,4S)-6-methyl-4-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-(1,2,3,6-tetrahydropyridine-5-carbonylamino)pentanoyl]amino]pentanoyl]amino]hept-2-enoate.
| Compound Name | ethyl (E,4S)-6-methyl-4-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-(1,2,3,6-tetrahydropyridine-5-carbonylamino)pentanoyl]amino]pentanoyl]amino]hept-2-enoate |
|---|---|
| PubChem CID | 11249418 |
| Molecular Formula | C28H48N4O5 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | ethyl (E,4S)-6-methyl-4-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-(1,2,3,6-tetrahydropyridine-5-carbonylamino)pentanoyl]amino]pentanoyl]amino]hept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)C1=CCCNC1 |
| InChI | InChI=1S/C28H48N4O5/c1-8-37-25(33)12-11-22(14-18(2)3)30-27(35)23(15-19(4)5)32-28(36)24(16-20(6)7)31-26(34)21-10-9-13-29-17-21/h10-12,18-20,22-24,29H,8-9,13-17H2,1-7H3,(H,30,35)(H,31,34)(H,32,36)/b12-11+/t22-,23+,24+/m1/s1 |
| InChIKey | TZDUGNSHEUDISW-PSKLOVCDSA-N |
| XLogP | 2.62 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|