C28H33N3O7 — CID 11249458
6-[[(2S)-2-(1-benzofuran-2-carbonylamino)-5-(phenylmethoxycarbonylamino)pentanoyl]amino]hexanoic acid (PubChem CID 11249458) has the molecular formula C28H33N3O7 and a molecular weight of 523.59 g/mol. Its IUPAC name is 6-[[(2S)-2-(1-benzofuran-2-carbonylamino)-5-(phenylmethoxycarbonylamino)pentanoyl]amino]hexanoic acid.
| Compound Name | 6-[[(2S)-2-(1-benzofuran-2-carbonylamino)-5-(phenylmethoxycarbonylamino)pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 11249458 |
| Molecular Formula | C28H33N3O7 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 6-[[(2S)-2-(1-benzofuran-2-carbonylamino)-5-(phenylmethoxycarbonylamino)pentanoyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)[C@H](CCCNC(=O)OCc1ccccc1)NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C28H33N3O7/c32-25(33)15-5-2-8-16-29-26(34)22(31-27(35)24-18-21-12-6-7-14-23(21)38-24)13-9-17-30-28(36)37-19-20-10-3-1-4-11-20/h1,3-4,6-7,10-12,14,18,22H,2,5,8-9,13,15-17,19H2,(H,29,34)(H,30,36)(H,31,35)(H,32,33)/t22-/m0/s1 |
| InChIKey | MFTMRQDQKJTSPG-QFIPXVFZSA-N |
| XLogP | 4.00 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|