C28H25F2N7O2 — CID 11249529
4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-nitro-5-(pyridin-4-ylmethyl)pyrimido[5,4-b]indole (PubChem CID 11249529) has the molecular formula C28H25F2N7O2 and a molecular weight of 529.55 g/mol. Its IUPAC name is 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-nitro-5-(pyridin-4-ylmethyl)pyrimido[5,4-b]indole.
| Compound Name | 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-nitro-5-(pyridin-4-ylmethyl)pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 11249529 |
| Molecular Formula | C28H25F2N7O2 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-nitro-5-(pyridin-4-ylmethyl)pyrimido[5,4-b]indole |
| SMILES | O=[N+]([O-])c1cccc2c1c1ncnc(N3CCN(CCc4ccc(F)c(F)c4)CC3)c1n2Cc1ccncc1 |
| InChI | InChI=1S/C28H25F2N7O2/c29-21-5-4-19(16-22(21)30)8-11-34-12-14-35(15-13-34)28-27-26(32-18-33-28)25-23(2-1-3-24(25)37(38)39)36(27)17-20-6-9-31-10-7-20/h1-7,9-10,16,18H,8,11-15,17H2 |
| InChIKey | OKLXZLLQLHWOGW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|