C28H37Cl2N5O — CID 11249545
4-[[N-cyclohexyl-C-[(2R,5S)-2,5-dimethylpiperazin-1-yl]carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide (PubChem CID 11249545) has the molecular formula C28H37Cl2N5O and a molecular weight of 530.54 g/mol. Its IUPAC name is 4-[[N-cyclohexyl-C-[(2R,5S)-2,5-dimethylpiperazin-1-yl]carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 4-[[N-cyclohexyl-C-[(2R,5S)-2,5-dimethylpiperazin-1-yl]carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 11249545 |
| Molecular Formula | C28H37Cl2N5O |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 4-[[N-cyclohexyl-C-[(2R,5S)-2,5-dimethylpiperazin-1-yl]carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
| SMILES | C[C@@H]1CN[C@@H](C)CN1/C(=N\C1CCCCC1)Nc1ccc(C(=O)NCCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C28H37Cl2N5O/c1-19-18-35(20(2)17-32-19)28(33-24-6-4-3-5-7-24)34-25-12-9-22(10-13-25)27(36)31-15-14-21-8-11-23(29)16-26(21)30/h8-13,16,19-20,24,32H,3-7,14-15,17-18H2,1-2H3,(H,31,36)(H,33,34)/t19-,20+/m0/s1 |
| InChIKey | LKFLMXAGXFBGSV-VQTJNVASSA-N |
| XLogP | 5.75 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|