C18H15ClF11NO3 — CID 11249661
ethyl (3R,4S,5S)-5-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-5-fluoro-2-methyl-3-phenyl-1,2-oxazolidine-4-carboxylate (PubChem CID 11249661) has the molecular formula C18H15ClF11NO3 and a molecular weight of 537.75 g/mol. Its IUPAC name is ethyl (3R,4S,5S)-5-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-5-fluoro-2-methyl-3-phenyl-1,2-oxazolidine-4-carboxylate.
| Compound Name | ethyl (3R,4S,5S)-5-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-5-fluoro-2-methyl-3-phenyl-1,2-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 11249661 |
| Molecular Formula | C18H15ClF11NO3 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | ethyl (3R,4S,5S)-5-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-5-fluoro-2-methyl-3-phenyl-1,2-oxazolidine-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](c2ccccc2)N(C)O[C@@]1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C18H15ClF11NO3/c1-3-33-12(32)10-11(9-7-5-4-6-8-9)31(2)34-13(10,20)14(21,22)15(23,24)16(25,26)17(27,28)18(19,29)30/h4-8,10-11H,3H2,1-2H3/t10-,11-,13+/m0/s1 |
| InChIKey | NYNNFNAPAXZDKK-GMXVVIOVSA-N |
| XLogP | 5.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|