C26H41IO3Si — CID 11249892
tert-butyl-[(Z,1S)-4-iodo-1-[(2R,7R)-7-[(1S)-1-phenylmethoxypropyl]-2,3,6,7-tetrahydrooxepin-2-yl]but-3-enoxy]-dimethylsilane (PubChem CID 11249892) has the molecular formula C26H41IO3Si and a molecular weight of 556.60 g/mol. Its IUPAC name is tert-butyl-[(Z,1S)-4-iodo-1-[(2R,7R)-7-[(1S)-1-phenylmethoxypropyl]-2,3,6,7-tetrahydrooxepin-2-yl]but-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,1S)-4-iodo-1-[(2R,7R)-7-[(1S)-1-phenylmethoxypropyl]-2,3,6,7-tetrahydrooxepin-2-yl]but-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11249892 |
| Molecular Formula | C26H41IO3Si |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | tert-butyl-[(Z,1S)-4-iodo-1-[(2R,7R)-7-[(1S)-1-phenylmethoxypropyl]-2,3,6,7-tetrahydrooxepin-2-yl]but-3-enoxy]-dimethylsilane |
| SMILES | CC[C@H](OCc1ccccc1)[C@H]1CC=CC[C@H]([C@H](C/C=C\I)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C26H41IO3Si/c1-7-22(28-20-21-14-9-8-10-15-21)23-16-11-12-17-24(29-23)25(18-13-19-27)30-31(5,6)26(2,3)4/h8-15,19,22-25H,7,16-18,20H2,1-6H3/b19-13-/t22-,23+,24+,25-/m0/s1 |
| InChIKey | JLACIKXALPCMTJ-FLSJCHBXSA-N |
| XLogP | 7.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|