C32H50O6Si — CID 11249934
(6R)-1-[(4S,6R)-6-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-8-methylidene-6-triethylsilyloxydec-3-yn-2-one (PubChem CID 11249934) has the molecular formula C32H50O6Si and a molecular weight of 558.83 g/mol. Its IUPAC name is (6R)-1-[(4S,6R)-6-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-8-methylidene-6-triethylsilyloxydec-3-yn-2-one.
| Compound Name | (6R)-1-[(4S,6R)-6-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-8-methylidene-6-triethylsilyloxydec-3-yn-2-one |
|---|---|
| PubChem CID | 11249934 |
| Molecular Formula | C32H50O6Si |
| Molecular Weight | 558.83 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | (6R)-1-[(4S,6R)-6-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-8-methylidene-6-triethylsilyloxydec-3-yn-2-one |
| SMILES | C=C(CC)C[C@H](CC#CC(=O)C[C@@H]1C[C@H](COCc2ccc(OC)cc2)OC(C)(C)O1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H50O6Si/c1-9-25(5)20-29(38-39(10-2,11-3)12-4)15-13-14-27(33)21-30-22-31(37-32(6,7)36-30)24-35-23-26-16-18-28(34-8)19-17-26/h16-19,29-31H,5,9-12,15,20-24H2,1-4,6-8H3/t29-,30+,31+/m0/s1 |
| InChIKey | HBDNOIGTNQEFMP-OJDZSJEKSA-N |
| XLogP | 7.22 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.83 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|