C8H11NO4 — CID 11249938
methyl (2E,4Z)-7-nitrohepta-2,4-dienoate (PubChem CID 11249938) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is methyl (2E,4Z)-7-nitrohepta-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-7-nitrohepta-2,4-dienoate |
|---|---|
| PubChem CID | 11249938 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | methyl (2E,4Z)-7-nitrohepta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C\CC[N+](=O)[O-] |
| InChI | InChI=1S/C8H11NO4/c1-13-8(10)6-4-2-3-5-7-9(11)12/h2-4,6H,5,7H2,1H3/b3-2-,6-4+ |
| InChIKey | YOVSFQPTZNDEBS-MGLVMYNNSA-N |
| XLogP | 0.94 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|