C10H11NO2 — CID 112500460
5-[(2R)-aziridin-2-yl]-2,3-dimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 112500460) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 5-[(2R)-aziridin-2-yl]-2,3-dimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 5-[(2R)-aziridin-2-yl]-2,3-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 112500460 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 5-[(2R)-aziridin-2-yl]-2,3-dimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C([C@@H]2CN2)=CC1=O |
| InChI | InChI=1S/C10H11NO2/c1-5-6(2)10(13)7(3-9(5)12)8-4-11-8/h3,8,11H,4H2,1-2H3/t8-/m0/s1 |
| InChIKey | OBADAGVBVREKPZ-QMMMGPOBSA-N |
| XLogP | 0.37 |
| TPSA | 56.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|